C11H11FN4OS — CID 108756422
N-(3-ethylsulfanyl-1H-1,2,4-triazol-5-yl)-2-fluorobenzamide (PubChem CID 108756422) has the molecular formula C11H11FN4OS and a molecular weight of 266.30 g/mol. Its IUPAC name is N-(3-ethylsulfanyl-1H-1,2,4-triazol-5-yl)-2-fluorobenzamide.
| Compound Name | N-(3-ethylsulfanyl-1H-1,2,4-triazol-5-yl)-2-fluorobenzamide |
|---|---|
| PubChem CID | 108756422 |
| Molecular Formula | C11H11FN4OS |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.06 |
| IUPAC Name | N-(3-ethylsulfanyl-1H-1,2,4-triazol-5-yl)-2-fluorobenzamide |
| SMILES | CCSc1n[nH]c(NC(=O)c2ccccc2F)n1 |
| InChI | InChI=1S/C11H11FN4OS/c1-2-18-11-14-10(15-16-11)13-9(17)7-5-3-4-6-8(7)12/h3-6H,2H2,1H3,(H2,13,14,15,16,17) |
| InChIKey | CQEDTYIWCRUFQH-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |