C21H17F3N4O — CID 108736723
[4-(6-phenylpyrimidin-4-yl)piperazin-1-yl]-(2,3,4-trifluorophenyl)methanone (PubChem CID 108736723) has the molecular formula C21H17F3N4O and a molecular weight of 398.39 g/mol. Its IUPAC name is [4-(6-phenylpyrimidin-4-yl)piperazin-1-yl]-(2,3,4-trifluorophenyl)methanone.
| Compound Name | [4-(6-phenylpyrimidin-4-yl)piperazin-1-yl]-(2,3,4-trifluorophenyl)methanone |
|---|---|
| PubChem CID | 108736723 |
| Molecular Formula | C21H17F3N4O |
| Molecular Weight | 398.39 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | [4-(6-phenylpyrimidin-4-yl)piperazin-1-yl]-(2,3,4-trifluorophenyl)methanone |
| SMILES | O=C(c1ccc(F)c(F)c1F)N1CCN(c2cc(-c3ccccc3)ncn2)CC1 |
| InChI | InChI=1S/C21H17F3N4O/c22-16-7-6-15(19(23)20(16)24)21(29)28-10-8-27(9-11-28)18-12-17(25-13-26-18)14-4-2-1-3-5-14/h1-7,12-13H,8-11H2 |
| InChIKey | DMMNVAAUAIGBPM-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.39 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|