C19H23ClN4O — CID 108759625
3-chloro-2,2-dimethyl-1-[4-(6-phenylpyrimidin-4-yl)piperazin-1-yl]propan-1-one (PubChem CID 108759625) has the molecular formula C19H23ClN4O and a molecular weight of 358.87 g/mol. Its IUPAC name is 3-chloro-2,2-dimethyl-1-[4-(6-phenylpyrimidin-4-yl)piperazin-1-yl]propan-1-one.
| Compound Name | 3-chloro-2,2-dimethyl-1-[4-(6-phenylpyrimidin-4-yl)piperazin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 108759625 |
| Molecular Formula | C19H23ClN4O |
| Molecular Weight | 358.87 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | 3-chloro-2,2-dimethyl-1-[4-(6-phenylpyrimidin-4-yl)piperazin-1-yl]propan-1-one |
| SMILES | CC(C)(CCl)C(=O)N1CCN(c2cc(-c3ccccc3)ncn2)CC1 |
| InChI | InChI=1S/C19H23ClN4O/c1-19(2,13-20)18(25)24-10-8-23(9-11-24)17-12-16(21-14-22-17)15-6-4-3-5-7-15/h3-7,12,14H,8-11,13H2,1-2H3 |
| InChIKey | XPOWOIWSGWHZPP-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.87 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|