C22H19N3O7 — CID 10873810
[4-benzamido-1-[(2R,4S,5S)-4,5-dihydroxyoxolan-2-yl]-2-oxopyrimidin-5-yl] benzoate (PubChem CID 10873810) has the molecular formula C22H19N3O7 and a molecular weight of 437.41 g/mol. Its IUPAC name is [4-benzamido-1-[(2R,4S,5S)-4,5-dihydroxyoxolan-2-yl]-2-oxopyrimidin-5-yl] benzoate.
| Compound Name | [4-benzamido-1-[(2R,4S,5S)-4,5-dihydroxyoxolan-2-yl]-2-oxopyrimidin-5-yl] benzoate |
|---|---|
| PubChem CID | 10873810 |
| Molecular Formula | C22H19N3O7 |
| Molecular Weight | 437.41 g/mol |
| Exact Mass | 437.12 |
| IUPAC Name | [4-benzamido-1-[(2R,4S,5S)-4,5-dihydroxyoxolan-2-yl]-2-oxopyrimidin-5-yl] benzoate |
| SMILES | O=C(Nc1nc(=O)n([C@H]2C[C@H](O)[C@@H](O)O2)cc1OC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H19N3O7/c26-15-11-17(32-21(15)29)25-12-16(31-20(28)14-9-5-2-6-10-14)18(24-22(25)30)23-19(27)13-7-3-1-4-8-13/h1-10,12,15,17,21,26,29H,11H2,(H,23,24,27,30)/t15-,17+,21-/m0/s1 |
| InChIKey | MEJQVALPNCQECP-XPIZARPCSA-N |
| XLogP | 1.31 |
| TPSA | 139.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.41 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |