C24H27N7O3 — CID 108741361
[4-(4-methylpiperazin-1-yl)-3-nitrophenyl]-(4-quinoxalin-2-ylpiperazin-1-yl)methanone (PubChem CID 108741361) has the molecular formula C24H27N7O3 and a molecular weight of 461.53 g/mol. Its IUPAC name is [4-(4-methylpiperazin-1-yl)-3-nitrophenyl]-(4-quinoxalin-2-ylpiperazin-1-yl)methanone.
| Compound Name | [4-(4-methylpiperazin-1-yl)-3-nitrophenyl]-(4-quinoxalin-2-ylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 108741361 |
| Molecular Formula | C24H27N7O3 |
| Molecular Weight | 461.53 g/mol |
| Exact Mass | 461.22 |
| IUPAC Name | [4-(4-methylpiperazin-1-yl)-3-nitrophenyl]-(4-quinoxalin-2-ylpiperazin-1-yl)methanone |
| SMILES | CN1CCN(c2ccc(C(=O)N3CCN(c4cnc5ccccc5n4)CC3)cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C24H27N7O3/c1-27-8-10-28(11-9-27)21-7-6-18(16-22(21)31(33)34)24(32)30-14-12-29(13-15-30)23-17-25-19-4-2-3-5-20(19)26-23/h2-7,16-17H,8-15H2,1H3 |
| InChIKey | ZUWAMMAXVANNTE-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 98.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.53 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|