C14H18Cl3N3O — CID 108743657
2,2,2-trichloro-N-[4-[(4-methylpiperazin-1-yl)methyl]phenyl]acetamide (PubChem CID 108743657) has the molecular formula C14H18Cl3N3O and a molecular weight of 350.68 g/mol. Its IUPAC name is 2,2,2-trichloro-N-[4-[(4-methylpiperazin-1-yl)methyl]phenyl]acetamide.
| Compound Name | 2,2,2-trichloro-N-[4-[(4-methylpiperazin-1-yl)methyl]phenyl]acetamide |
|---|---|
| PubChem CID | 108743657 |
| Molecular Formula | C14H18Cl3N3O |
| Molecular Weight | 350.68 g/mol |
| Exact Mass | 349.05 |
| IUPAC Name | 2,2,2-trichloro-N-[4-[(4-methylpiperazin-1-yl)methyl]phenyl]acetamide |
| SMILES | CN1CCN(Cc2ccc(NC(=O)C(Cl)(Cl)Cl)cc2)CC1 |
| InChI | InChI=1S/C14H18Cl3N3O/c1-19-6-8-20(9-7-19)10-11-2-4-12(5-3-11)18-13(21)14(15,16)17/h2-5H,6-10H2,1H3,(H,18,21) |
| InChIKey | FFKGWLVZWASNGO-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.68 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|