C21H21N5O2S2 — CID 108744077
5-oxo-1-(4-pyrrolidin-1-ylphenyl)-N-(5-thiophen-2-yl-1,3,4-thiadiazol-2-yl)pyrrolidine-3-carboxamide (PubChem CID 108744077) has the molecular formula C21H21N5O2S2 and a molecular weight of 439.57 g/mol. Its IUPAC name is 5-oxo-1-(4-pyrrolidin-1-ylphenyl)-N-(5-thiophen-2-yl-1,3,4-thiadiazol-2-yl)pyrrolidine-3-carboxamide.
| Compound Name | 5-oxo-1-(4-pyrrolidin-1-ylphenyl)-N-(5-thiophen-2-yl-1,3,4-thiadiazol-2-yl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 108744077 |
| Molecular Formula | C21H21N5O2S2 |
| Molecular Weight | 439.57 g/mol |
| Exact Mass | 439.11 |
| IUPAC Name | 5-oxo-1-(4-pyrrolidin-1-ylphenyl)-N-(5-thiophen-2-yl-1,3,4-thiadiazol-2-yl)pyrrolidine-3-carboxamide |
| SMILES | O=C(Nc1nnc(-c2cccs2)s1)C1CC(=O)N(c2ccc(N3CCCC3)cc2)C1 |
| InChI | InChI=1S/C21H21N5O2S2/c27-18-12-14(19(28)22-21-24-23-20(30-21)17-4-3-11-29-17)13-26(18)16-7-5-15(6-8-16)25-9-1-2-10-25/h3-8,11,14H,1-2,9-10,12-13H2,(H,22,24,28) |
| InChIKey | LMNBBUPSEZEVFC-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.57 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|