C21H27N3O3S — CID 108744577
2-[(2-ethyl-3,4-dihydro-1H-benzo[b][1,6]naphthyridine-10-carbonyl)amino]-4-ethylsulfanylbutanoic acid (PubChem CID 108744577) has the molecular formula C21H27N3O3S and a molecular weight of 401.53 g/mol. Its IUPAC name is 2-[(2-ethyl-3,4-dihydro-1H-benzo[b][1,6]naphthyridine-10-carbonyl)amino]-4-ethylsulfanylbutanoic acid.
| Compound Name | 2-[(2-ethyl-3,4-dihydro-1H-benzo[b][1,6]naphthyridine-10-carbonyl)amino]-4-ethylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 108744577 |
| Molecular Formula | C21H27N3O3S |
| Molecular Weight | 401.53 g/mol |
| Exact Mass | 401.18 |
| IUPAC Name | 2-[(2-ethyl-3,4-dihydro-1H-benzo[b][1,6]naphthyridine-10-carbonyl)amino]-4-ethylsulfanylbutanoic acid |
| SMILES | CCSCCC(NC(=O)c1c2c(nc3ccccc13)CCN(CC)C2)C(=O)O |
| InChI | InChI=1S/C21H27N3O3S/c1-3-24-11-9-17-15(13-24)19(14-7-5-6-8-16(14)22-17)20(25)23-18(21(26)27)10-12-28-4-2/h5-8,18H,3-4,9-13H2,1-2H3,(H,23,25)(H,26,27) |
| InChIKey | UMZHOCAVYJRNBG-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 82.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.53 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|