C29H23N3O3 — CID 108792798
N-(9,10-dioxoanthracen-1-yl)-2-ethyl-3,4-dihydro-1H-benzo[b][1,6]naphthyridine-10-carboxamide (PubChem CID 108792798) has the molecular formula C29H23N3O3 and a molecular weight of 461.52 g/mol. Its IUPAC name is N-(9,10-dioxoanthracen-1-yl)-2-ethyl-3,4-dihydro-1H-benzo[b][1,6]naphthyridine-10-carboxamide.
| Compound Name | N-(9,10-dioxoanthracen-1-yl)-2-ethyl-3,4-dihydro-1H-benzo[b][1,6]naphthyridine-10-carboxamide |
|---|---|
| PubChem CID | 108792798 |
| Molecular Formula | C29H23N3O3 |
| Molecular Weight | 461.52 g/mol |
| Exact Mass | 461.17 |
| IUPAC Name | N-(9,10-dioxoanthracen-1-yl)-2-ethyl-3,4-dihydro-1H-benzo[b][1,6]naphthyridine-10-carboxamide |
| SMILES | CCN1CCc2nc3ccccc3c(C(=O)Nc3cccc4c3C(=O)c3ccccc3C4=O)c2C1 |
| InChI | InChI=1S/C29H23N3O3/c1-2-32-15-14-23-21(16-32)25(19-10-5-6-12-22(19)30-23)29(35)31-24-13-7-11-20-26(24)28(34)18-9-4-3-8-17(18)27(20)33/h3-13H,2,14-16H2,1H3,(H,31,35) |
| InChIKey | XMYCTWJPDYOPHC-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.52 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|