C23H23N3O4 — CID 108745839
methyl 3-[(2-ethyl-3,4-dihydro-1H-benzo[b][1,6]naphthyridine-10-carbonyl)amino]-2-hydroxybenzoate (PubChem CID 108745839) has the molecular formula C23H23N3O4 and a molecular weight of 405.45 g/mol. Its IUPAC name is methyl 3-[(2-ethyl-3,4-dihydro-1H-benzo[b][1,6]naphthyridine-10-carbonyl)amino]-2-hydroxybenzoate.
| Compound Name | methyl 3-[(2-ethyl-3,4-dihydro-1H-benzo[b][1,6]naphthyridine-10-carbonyl)amino]-2-hydroxybenzoate |
|---|---|
| PubChem CID | 108745839 |
| Molecular Formula | C23H23N3O4 |
| Molecular Weight | 405.45 g/mol |
| Exact Mass | 405.17 |
| IUPAC Name | methyl 3-[(2-ethyl-3,4-dihydro-1H-benzo[b][1,6]naphthyridine-10-carbonyl)amino]-2-hydroxybenzoate |
| SMILES | CCN1CCc2nc3ccccc3c(C(=O)Nc3cccc(C(=O)OC)c3O)c2C1 |
| InChI | InChI=1S/C23H23N3O4/c1-3-26-12-11-18-16(13-26)20(14-7-4-5-9-17(14)24-18)22(28)25-19-10-6-8-15(21(19)27)23(29)30-2/h4-10,27H,3,11-13H2,1-2H3,(H,25,28) |
| InChIKey | TXEIIODFCQEGAG-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 91.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.45 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|