C18H16N4O3 — CID 108745436
3-[[(5-methyl-1-pyridin-2-ylpyrazole-4-carbonyl)amino]methyl]benzoic acid (PubChem CID 108745436) has the molecular formula C18H16N4O3 and a molecular weight of 336.35 g/mol. Its IUPAC name is 3-[[(5-methyl-1-pyridin-2-ylpyrazole-4-carbonyl)amino]methyl]benzoic acid.
| Compound Name | 3-[[(5-methyl-1-pyridin-2-ylpyrazole-4-carbonyl)amino]methyl]benzoic acid |
|---|---|
| PubChem CID | 108745436 |
| Molecular Formula | C18H16N4O3 |
| Molecular Weight | 336.35 g/mol |
| Exact Mass | 336.12 |
| IUPAC Name | 3-[[(5-methyl-1-pyridin-2-ylpyrazole-4-carbonyl)amino]methyl]benzoic acid |
| SMILES | Cc1c(C(=O)NCc2cccc(C(=O)O)c2)cnn1-c1ccccn1 |
| InChI | InChI=1S/C18H16N4O3/c1-12-15(11-21-22(12)16-7-2-3-8-19-16)17(23)20-10-13-5-4-6-14(9-13)18(24)25/h2-9,11H,10H2,1H3,(H,20,23)(H,24,25) |
| InChIKey | QAQLSVMFZQEVCE-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.35 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |