C21H20N4O4 — CID 108745836
methyl 3-[[3-[(4,6-dimethylpyrimidin-2-yl)amino]benzoyl]amino]-2-hydroxybenzoate (PubChem CID 108745836) has the molecular formula C21H20N4O4 and a molecular weight of 392.42 g/mol. Its IUPAC name is methyl 3-[[3-[(4,6-dimethylpyrimidin-2-yl)amino]benzoyl]amino]-2-hydroxybenzoate.
| Compound Name | methyl 3-[[3-[(4,6-dimethylpyrimidin-2-yl)amino]benzoyl]amino]-2-hydroxybenzoate |
|---|---|
| PubChem CID | 108745836 |
| Molecular Formula | C21H20N4O4 |
| Molecular Weight | 392.42 g/mol |
| Exact Mass | 392.15 |
| IUPAC Name | methyl 3-[[3-[(4,6-dimethylpyrimidin-2-yl)amino]benzoyl]amino]-2-hydroxybenzoate |
| SMILES | COC(=O)c1cccc(NC(=O)c2cccc(Nc3nc(C)cc(C)n3)c2)c1O |
| InChI | InChI=1S/C21H20N4O4/c1-12-10-13(2)23-21(22-12)24-15-7-4-6-14(11-15)19(27)25-17-9-5-8-16(18(17)26)20(28)29-3/h4-11,26H,1-3H3,(H,25,27)(H,22,23,24) |
| InChIKey | AHXBCMQWSJEZSZ-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 113.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.42 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|