C20H22N4O4 — CID 108747124
methyl 4-[[2-(8-methoxy-4-methylquinolin-2-yl)-5-methylpyrazol-3-yl]amino]-4-oxobutanoate (PubChem CID 108747124) has the molecular formula C20H22N4O4 and a molecular weight of 382.42 g/mol. Its IUPAC name is methyl 4-[[2-(8-methoxy-4-methylquinolin-2-yl)-5-methylpyrazol-3-yl]amino]-4-oxobutanoate.
| Compound Name | methyl 4-[[2-(8-methoxy-4-methylquinolin-2-yl)-5-methylpyrazol-3-yl]amino]-4-oxobutanoate |
|---|---|
| PubChem CID | 108747124 |
| Molecular Formula | C20H22N4O4 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | methyl 4-[[2-(8-methoxy-4-methylquinolin-2-yl)-5-methylpyrazol-3-yl]amino]-4-oxobutanoate |
| SMILES | COC(=O)CCC(=O)Nc1cc(C)nn1-c1cc(C)c2cccc(OC)c2n1 |
| InChI | InChI=1S/C20H22N4O4/c1-12-10-16(22-20-14(12)6-5-7-15(20)27-3)24-17(11-13(2)23-24)21-18(25)8-9-19(26)28-4/h5-7,10-11H,8-9H2,1-4H3,(H,21,25) |
| InChIKey | KQXUYXPHYPJTSD-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 95.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |