C25H25ClN4O3 — CID 108769248
4-(4-chlorophenoxy)-N-[2-(8-methoxy-4-methylquinolin-2-yl)-5-methylpyrazol-3-yl]butanamide (PubChem CID 108769248) has the molecular formula C25H25ClN4O3 and a molecular weight of 464.95 g/mol. Its IUPAC name is 4-(4-chlorophenoxy)-N-[2-(8-methoxy-4-methylquinolin-2-yl)-5-methylpyrazol-3-yl]butanamide.
| Compound Name | 4-(4-chlorophenoxy)-N-[2-(8-methoxy-4-methylquinolin-2-yl)-5-methylpyrazol-3-yl]butanamide |
|---|---|
| PubChem CID | 108769248 |
| Molecular Formula | C25H25ClN4O3 |
| Molecular Weight | 464.95 g/mol |
| Exact Mass | 464.16 |
| IUPAC Name | 4-(4-chlorophenoxy)-N-[2-(8-methoxy-4-methylquinolin-2-yl)-5-methylpyrazol-3-yl]butanamide |
| SMILES | COc1cccc2c(C)cc(-n3nc(C)cc3NC(=O)CCCOc3ccc(Cl)cc3)nc12 |
| InChI | InChI=1S/C25H25ClN4O3/c1-16-14-22(28-25-20(16)6-4-7-21(25)32-3)30-23(15-17(2)29-30)27-24(31)8-5-13-33-19-11-9-18(26)10-12-19/h4,6-7,9-12,14-15H,5,8,13H2,1-3H3,(H,27,31) |
| InChIKey | MSHCHFHIFCRSBV-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.95 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|