About N-[4-cyano-1-(4,8-dimethylquinolin-2-yl)pyrazol-5-yl]-4-(4-methoxyphenoxy)butanamide
N-[4-cyano-1-(4,8-dimethylquinolin-2-yl)pyrazol-5-yl]-4-(4-methoxyphenoxy)butanamide (PubChem CID 108769476) has the molecular formula C26H25N5O3
and a molecular weight of 455.52 g/mol. Its IUPAC name is N-[4-cyano-1-(4,8-dimethylquinolin-2-yl)pyrazol-5-yl]-4-(4-methoxyphenoxy)butanamide.
Molecular Properties
| Compound Name | N-[4-cyano-1-(4,8-dimethylquinolin-2-yl)pyrazol-5-yl]-4-(4-methoxyphenoxy)butanamide |
| PubChem CID | 108769476 |
| Molecular Formula | C26H25N5O3 |
| Molecular Weight | 455.52 g/mol |
| Exact Mass | 455.20 |
| IUPAC Name | N-[4-cyano-1-(4,8-dimethylquinolin-2-yl)pyrazol-5-yl]-4-(4-methoxyphenoxy)butanamide |
| SMILES | COc1ccc(OCCCC(=O)Nc2c(C#N)cnn2-c2cc(C)c3cccc(C)c3n2)cc1 |
| InChI | InChI=1S/C26H25N5O3/c1-17-6-4-7-22-18(2)14-23(29-25(17)22)31-26(19(15-27)16-28-31)30-24(32)8-5-13-34-21-11-9-20(33-3)10-12-21/h4,6-7,9-12,14,16H,5,8,13H2,1-3H3,(H,30,32) |
| InChIKey | AKUOUAOTBHOHAA-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 102.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 455.52 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[4-cyano-1-(4,8-dimethylquinolin-2-yl)pyrazol-5-yl]-4-(4-methoxyphenoxy)butanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-cyano-1-(4,8-dimethylquinolin-2-yl)pyrazol-5-yl]-4-(4-methoxyphenoxy)butanamide?
The IUPAC name of N-[4-cyano-1-(4,8-dimethylquinolin-2-yl)pyrazol-5-yl]-4-(4-methoxyphenoxy)butanamide (CID 108769476) is N-[4-cyano-1-(4,8-dimethylquinolin-2-yl)pyrazol-5-yl]-4-(4-methoxyphenoxy)butanamide.
What is the SMILES notation for N-[4-cyano-1-(4,8-dimethylquinolin-2-yl)pyrazol-5-yl]-4-(4-methoxyphenoxy)butanamide?
The canonical SMILES for N-[4-cyano-1-(4,8-dimethylquinolin-2-yl)pyrazol-5-yl]-4-(4-methoxyphenoxy)butanamide is COc1ccc(OCCCC(=O)Nc2c(C#N)cnn2-c2cc(C)c3cccc(C)c3n2)cc1.
What is the InChIKey of N-[4-cyano-1-(4,8-dimethylquinolin-2-yl)pyrazol-5-yl]-4-(4-methoxyphenoxy)butanamide?
The InChIKey is AKUOUAOTBHOHAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H25N5O3/c1-17-6-4-7-22-18(2)14-23(29-25(17)22)31-26(19(15-27)16-28-31)30-24(32)8-5-13-34-21-11-9-20(33-3)10-12-21/h4,6-7,9-12,14,16H,5,8,13H2,1-3H3,(H,30,32).
What are the key properties of N-[4-cyano-1-(4,8-dimethylquinolin-2-yl)pyrazol-5-yl]-4-(4-methoxyphenoxy)butanamide?
N-[4-cyano-1-(4,8-dimethylquinolin-2-yl)pyrazol-5-yl]-4-(4-methoxyphenoxy)butanamide has a molecular weight of 455.52 g/mol, XLogP of 4.72, 8 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-cyano-1-(4,8-dimethylquinolin-2-yl)pyrazol-5-yl]-4-(4-methoxyphenoxy)butanamide is sourced from PubChem (CID 108769476), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).