C18H16ClN5O3 — CID 108747474
2-chloroethyl N-[4-cyano-1-(8-methoxy-4-methylquinolin-2-yl)pyrazol-5-yl]carbamate (PubChem CID 108747474) has the molecular formula C18H16ClN5O3 and a molecular weight of 385.81 g/mol. Its IUPAC name is 2-chloroethyl N-[4-cyano-1-(8-methoxy-4-methylquinolin-2-yl)pyrazol-5-yl]carbamate.
| Compound Name | 2-chloroethyl N-[4-cyano-1-(8-methoxy-4-methylquinolin-2-yl)pyrazol-5-yl]carbamate |
|---|---|
| PubChem CID | 108747474 |
| Molecular Formula | C18H16ClN5O3 |
| Molecular Weight | 385.81 g/mol |
| Exact Mass | 385.09 |
| IUPAC Name | 2-chloroethyl N-[4-cyano-1-(8-methoxy-4-methylquinolin-2-yl)pyrazol-5-yl]carbamate |
| SMILES | COc1cccc2c(C)cc(-n3ncc(C#N)c3NC(=O)OCCCl)nc12 |
| InChI | InChI=1S/C18H16ClN5O3/c1-11-8-15(22-16-13(11)4-3-5-14(16)26-2)24-17(12(9-20)10-21-24)23-18(25)27-7-6-19/h3-5,8,10H,6-7H2,1-2H3,(H,23,25) |
| InChIKey | WKZUBNUBEMLKCS-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 102.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.81 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|