C23H17N7O6 — CID 108747463
N-[4-cyano-1-(8-methoxy-4-methylquinolin-2-yl)pyrazol-5-yl]-2-methyl-3,5-dinitrobenzamide (PubChem CID 108747463) has the molecular formula C23H17N7O6 and a molecular weight of 487.43 g/mol. Its IUPAC name is N-[4-cyano-1-(8-methoxy-4-methylquinolin-2-yl)pyrazol-5-yl]-2-methyl-3,5-dinitrobenzamide.
| Compound Name | N-[4-cyano-1-(8-methoxy-4-methylquinolin-2-yl)pyrazol-5-yl]-2-methyl-3,5-dinitrobenzamide |
|---|---|
| PubChem CID | 108747463 |
| Molecular Formula | C23H17N7O6 |
| Molecular Weight | 487.43 g/mol |
| Exact Mass | 487.12 |
| IUPAC Name | N-[4-cyano-1-(8-methoxy-4-methylquinolin-2-yl)pyrazol-5-yl]-2-methyl-3,5-dinitrobenzamide |
| SMILES | COc1cccc2c(C)cc(-n3ncc(C#N)c3NC(=O)c3cc([N+](=O)[O-])cc([N+](=O)[O-])c3C)nc12 |
| InChI | InChI=1S/C23H17N7O6/c1-12-7-20(26-21-16(12)5-4-6-19(21)36-3)28-22(14(10-24)11-25-28)27-23(31)17-8-15(29(32)33)9-18(13(17)2)30(34)35/h4-9,11H,1-3H3,(H,27,31) |
| InChIKey | BWKIDOREWBVUNY-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 179.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.43 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|