C19H13ClN8O3 — CID 108779323
5-[(6-chloro-5-nitropyrimidin-4-yl)amino]-1-(8-methoxy-4-methylquinolin-2-yl)pyrazole-4-carbonitrile (PubChem CID 108779323) has the molecular formula C19H13ClN8O3 and a molecular weight of 436.82 g/mol. Its IUPAC name is 5-[(6-chloro-5-nitropyrimidin-4-yl)amino]-1-(8-methoxy-4-methylquinolin-2-yl)pyrazole-4-carbonitrile.
| Compound Name | 5-[(6-chloro-5-nitropyrimidin-4-yl)amino]-1-(8-methoxy-4-methylquinolin-2-yl)pyrazole-4-carbonitrile |
|---|---|
| PubChem CID | 108779323 |
| Molecular Formula | C19H13ClN8O3 |
| Molecular Weight | 436.82 g/mol |
| Exact Mass | 436.08 |
| IUPAC Name | 5-[(6-chloro-5-nitropyrimidin-4-yl)amino]-1-(8-methoxy-4-methylquinolin-2-yl)pyrazole-4-carbonitrile |
| SMILES | COc1cccc2c(C)cc(-n3ncc(C#N)c3Nc3ncnc(Cl)c3[N+](=O)[O-])nc12 |
| InChI | InChI=1S/C19H13ClN8O3/c1-10-6-14(25-15-12(10)4-3-5-13(15)31-2)27-19(11(7-21)8-24-27)26-18-16(28(29)30)17(20)22-9-23-18/h3-6,8-9H,1-2H3,(H,22,23,26) |
| InChIKey | DQXNLCZEVHOCAE-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 144.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.82 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|