C20H17N9O2 — CID 108778836
5-[(6-amino-5-nitropyrimidin-4-yl)amino]-1-(4,6,8-trimethylquinolin-2-yl)pyrazole-4-carbonitrile (PubChem CID 108778836) has the molecular formula C20H17N9O2 and a molecular weight of 415.42 g/mol. Its IUPAC name is 5-[(6-amino-5-nitropyrimidin-4-yl)amino]-1-(4,6,8-trimethylquinolin-2-yl)pyrazole-4-carbonitrile.
| Compound Name | 5-[(6-amino-5-nitropyrimidin-4-yl)amino]-1-(4,6,8-trimethylquinolin-2-yl)pyrazole-4-carbonitrile |
|---|---|
| PubChem CID | 108778836 |
| Molecular Formula | C20H17N9O2 |
| Molecular Weight | 415.42 g/mol |
| Exact Mass | 415.15 |
| IUPAC Name | 5-[(6-amino-5-nitropyrimidin-4-yl)amino]-1-(4,6,8-trimethylquinolin-2-yl)pyrazole-4-carbonitrile |
| SMILES | Cc1cc(C)c2nc(-n3ncc(C#N)c3Nc3ncnc(N)c3[N+](=O)[O-])cc(C)c2c1 |
| InChI | InChI=1S/C20H17N9O2/c1-10-4-12(3)16-14(5-10)11(2)6-15(26-16)28-20(13(7-21)8-25-28)27-19-17(29(30)31)18(22)23-9-24-19/h4-6,8-9H,1-3H3,(H3,22,23,24,27) |
| InChIKey | ZTBKMPZNHCGRSM-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 161.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.42 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|