C18H13N9O2 — CID 108779253
5-[(6-amino-5-nitropyrimidin-4-yl)amino]-1-(4-methylquinolin-2-yl)pyrazole-4-carbonitrile (PubChem CID 108779253) has the molecular formula C18H13N9O2 and a molecular weight of 387.36 g/mol. Its IUPAC name is 5-[(6-amino-5-nitropyrimidin-4-yl)amino]-1-(4-methylquinolin-2-yl)pyrazole-4-carbonitrile.
| Compound Name | 5-[(6-amino-5-nitropyrimidin-4-yl)amino]-1-(4-methylquinolin-2-yl)pyrazole-4-carbonitrile |
|---|---|
| PubChem CID | 108779253 |
| Molecular Formula | C18H13N9O2 |
| Molecular Weight | 387.36 g/mol |
| Exact Mass | 387.12 |
| IUPAC Name | 5-[(6-amino-5-nitropyrimidin-4-yl)amino]-1-(4-methylquinolin-2-yl)pyrazole-4-carbonitrile |
| SMILES | Cc1cc(-n2ncc(C#N)c2Nc2ncnc(N)c2[N+](=O)[O-])nc2ccccc12 |
| InChI | InChI=1S/C18H13N9O2/c1-10-6-14(24-13-5-3-2-4-12(10)13)26-18(11(7-19)8-23-26)25-17-15(27(28)29)16(20)21-9-22-17/h2-6,8-9H,1H3,(H3,20,21,22,25) |
| InChIKey | DHDQWOYTEIXHDU-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 161.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.36 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|