C24H16N8O2 — CID 108779237
1-(4-methylquinolin-2-yl)-5-[[6-(3-nitrophenyl)pyridazin-3-yl]amino]pyrazole-4-carbonitrile (PubChem CID 108779237) has the molecular formula C24H16N8O2 and a molecular weight of 448.45 g/mol. Its IUPAC name is 1-(4-methylquinolin-2-yl)-5-[[6-(3-nitrophenyl)pyridazin-3-yl]amino]pyrazole-4-carbonitrile.
| Compound Name | 1-(4-methylquinolin-2-yl)-5-[[6-(3-nitrophenyl)pyridazin-3-yl]amino]pyrazole-4-carbonitrile |
|---|---|
| PubChem CID | 108779237 |
| Molecular Formula | C24H16N8O2 |
| Molecular Weight | 448.45 g/mol |
| Exact Mass | 448.14 |
| IUPAC Name | 1-(4-methylquinolin-2-yl)-5-[[6-(3-nitrophenyl)pyridazin-3-yl]amino]pyrazole-4-carbonitrile |
| SMILES | Cc1cc(-n2ncc(C#N)c2Nc2ccc(-c3cccc([N+](=O)[O-])c3)nn2)nc2ccccc12 |
| InChI | InChI=1S/C24H16N8O2/c1-15-11-23(27-21-8-3-2-7-19(15)21)31-24(17(13-25)14-26-31)28-22-10-9-20(29-30-22)16-5-4-6-18(12-16)32(33)34/h2-12,14H,1H3,(H,28,30) |
| InChIKey | LBIZOXAWEPWVRJ-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 135.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.45 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|