C25H19N7O4 — CID 108778941
ethyl 5-[[6-(3-nitrophenyl)pyridazin-3-yl]amino]-1-quinolin-2-ylpyrazole-4-carboxylate (PubChem CID 108778941) has the molecular formula C25H19N7O4 and a molecular weight of 481.47 g/mol. Its IUPAC name is ethyl 5-[[6-(3-nitrophenyl)pyridazin-3-yl]amino]-1-quinolin-2-ylpyrazole-4-carboxylate.
| Compound Name | ethyl 5-[[6-(3-nitrophenyl)pyridazin-3-yl]amino]-1-quinolin-2-ylpyrazole-4-carboxylate |
|---|---|
| PubChem CID | 108778941 |
| Molecular Formula | C25H19N7O4 |
| Molecular Weight | 481.47 g/mol |
| Exact Mass | 481.15 |
| IUPAC Name | ethyl 5-[[6-(3-nitrophenyl)pyridazin-3-yl]amino]-1-quinolin-2-ylpyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cnn(-c2ccc3ccccc3n2)c1Nc1ccc(-c2cccc([N+](=O)[O-])c2)nn1 |
| InChI | InChI=1S/C25H19N7O4/c1-2-36-25(33)19-15-26-31(23-13-10-16-6-3-4-9-20(16)27-23)24(19)28-22-12-11-21(29-30-22)17-7-5-8-18(14-17)32(34)35/h3-15H,2H2,1H3,(H,28,30) |
| InChIKey | DGPKONNIYSDORH-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 137.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.47 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|