C23H15N7 — CID 108779144
5-[(6-phenylpyridazin-3-yl)amino]-1-quinolin-2-ylpyrazole-4-carbonitrile (PubChem CID 108779144) has the molecular formula C23H15N7 and a molecular weight of 389.42 g/mol. Its IUPAC name is 5-[(6-phenylpyridazin-3-yl)amino]-1-quinolin-2-ylpyrazole-4-carbonitrile.
| Compound Name | 5-[(6-phenylpyridazin-3-yl)amino]-1-quinolin-2-ylpyrazole-4-carbonitrile |
|---|---|
| PubChem CID | 108779144 |
| Molecular Formula | C23H15N7 |
| Molecular Weight | 389.42 g/mol |
| Exact Mass | 389.14 |
| IUPAC Name | 5-[(6-phenylpyridazin-3-yl)amino]-1-quinolin-2-ylpyrazole-4-carbonitrile |
| SMILES | N#Cc1cnn(-c2ccc3ccccc3n2)c1Nc1ccc(-c2ccccc2)nn1 |
| InChI | InChI=1S/C23H15N7/c24-14-18-15-25-30(22-13-10-17-8-4-5-9-19(17)26-22)23(18)27-21-12-11-20(28-29-21)16-6-2-1-3-7-16/h1-13,15H,(H,27,29) |
| InChIKey | OSMINKMVTQTSIO-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 92.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.42 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |