C18H13N5O5 — CID 108774245
methyl 4-cyano-2-methyl-5-[[6-(3-nitrophenyl)pyridazin-3-yl]amino]furan-3-carboxylate (PubChem CID 108774245) has the molecular formula C18H13N5O5 and a molecular weight of 379.33 g/mol. Its IUPAC name is methyl 4-cyano-2-methyl-5-[[6-(3-nitrophenyl)pyridazin-3-yl]amino]furan-3-carboxylate.
| Compound Name | methyl 4-cyano-2-methyl-5-[[6-(3-nitrophenyl)pyridazin-3-yl]amino]furan-3-carboxylate |
|---|---|
| PubChem CID | 108774245 |
| Molecular Formula | C18H13N5O5 |
| Molecular Weight | 379.33 g/mol |
| Exact Mass | 379.09 |
| IUPAC Name | methyl 4-cyano-2-methyl-5-[[6-(3-nitrophenyl)pyridazin-3-yl]amino]furan-3-carboxylate |
| SMILES | COC(=O)c1c(C)oc(Nc2ccc(-c3cccc([N+](=O)[O-])c3)nn2)c1C#N |
| InChI | InChI=1S/C18H13N5O5/c1-10-16(18(24)27-2)13(9-19)17(28-10)20-15-7-6-14(21-22-15)11-4-3-5-12(8-11)23(25)26/h3-8H,1-2H3,(H,20,22) |
| InChIKey | VPCXVXSGXIERCJ-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 144.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.33 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|