C19H16N4O4 — CID 108774286
methyl 4-cyano-5-[[6-(4-methoxyphenyl)pyridazin-3-yl]amino]-2-methylfuran-3-carboxylate (PubChem CID 108774286) has the molecular formula C19H16N4O4 and a molecular weight of 364.36 g/mol. Its IUPAC name is methyl 4-cyano-5-[[6-(4-methoxyphenyl)pyridazin-3-yl]amino]-2-methylfuran-3-carboxylate.
| Compound Name | methyl 4-cyano-5-[[6-(4-methoxyphenyl)pyridazin-3-yl]amino]-2-methylfuran-3-carboxylate |
|---|---|
| PubChem CID | 108774286 |
| Molecular Formula | C19H16N4O4 |
| Molecular Weight | 364.36 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | methyl 4-cyano-5-[[6-(4-methoxyphenyl)pyridazin-3-yl]amino]-2-methylfuran-3-carboxylate |
| SMILES | COC(=O)c1c(C)oc(Nc2ccc(-c3ccc(OC)cc3)nn2)c1C#N |
| InChI | InChI=1S/C19H16N4O4/c1-11-17(19(24)26-3)14(10-20)18(27-11)21-16-9-8-15(22-23-16)12-4-6-13(25-2)7-5-12/h4-9H,1-3H3,(H,21,23) |
| InChIKey | HWZRJLLWWNFLPK-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 110.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.36 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |