About N-[4-cyano-1-(4,8-dimethylquinolin-2-yl)pyrazol-5-yl]-2-methyl-3,5-dinitrobenzamide
N-[4-cyano-1-(4,8-dimethylquinolin-2-yl)pyrazol-5-yl]-2-methyl-3,5-dinitrobenzamide (PubChem CID 108747322) has the molecular formula C23H17N7O5
and a molecular weight of 471.43 g/mol. Its IUPAC name is N-[4-cyano-1-(4,8-dimethylquinolin-2-yl)pyrazol-5-yl]-2-methyl-3,5-dinitrobenzamide.
Molecular Properties
| Compound Name | N-[4-cyano-1-(4,8-dimethylquinolin-2-yl)pyrazol-5-yl]-2-methyl-3,5-dinitrobenzamide |
| PubChem CID | 108747322 |
| Molecular Formula | C23H17N7O5 |
| Molecular Weight | 471.43 g/mol |
| Exact Mass | 471.13 |
| IUPAC Name | N-[4-cyano-1-(4,8-dimethylquinolin-2-yl)pyrazol-5-yl]-2-methyl-3,5-dinitrobenzamide |
| SMILES | Cc1c(C(=O)Nc2c(C#N)cnn2-c2cc(C)c3cccc(C)c3n2)cc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C23H17N7O5/c1-12-5-4-6-17-13(2)7-20(26-21(12)17)28-22(15(10-24)11-25-28)27-23(31)18-8-16(29(32)33)9-19(14(18)3)30(34)35/h4-9,11H,1-3H3,(H,27,31) |
| InChIKey | MAFPFCZZXLEHTP-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 169.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 471.43 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[4-cyano-1-(4,8-dimethylquinolin-2-yl)pyrazol-5-yl]-2-methyl-3,5-dinitrobenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-cyano-1-(4,8-dimethylquinolin-2-yl)pyrazol-5-yl]-2-methyl-3,5-dinitrobenzamide?
The IUPAC name of N-[4-cyano-1-(4,8-dimethylquinolin-2-yl)pyrazol-5-yl]-2-methyl-3,5-dinitrobenzamide (CID 108747322) is N-[4-cyano-1-(4,8-dimethylquinolin-2-yl)pyrazol-5-yl]-2-methyl-3,5-dinitrobenzamide.
What is the SMILES notation for N-[4-cyano-1-(4,8-dimethylquinolin-2-yl)pyrazol-5-yl]-2-methyl-3,5-dinitrobenzamide?
The canonical SMILES for N-[4-cyano-1-(4,8-dimethylquinolin-2-yl)pyrazol-5-yl]-2-methyl-3,5-dinitrobenzamide is Cc1c(C(=O)Nc2c(C#N)cnn2-c2cc(C)c3cccc(C)c3n2)cc([N+](=O)[O-])cc1[N+](=O)[O-].
What is the InChIKey of N-[4-cyano-1-(4,8-dimethylquinolin-2-yl)pyrazol-5-yl]-2-methyl-3,5-dinitrobenzamide?
The InChIKey is MAFPFCZZXLEHTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H17N7O5/c1-12-5-4-6-17-13(2)7-20(26-21(12)17)28-22(15(10-24)11-25-28)27-23(31)18-8-16(29(32)33)9-19(14(18)3)30(34)35/h4-9,11H,1-3H3,(H,27,31).
What are the key properties of N-[4-cyano-1-(4,8-dimethylquinolin-2-yl)pyrazol-5-yl]-2-methyl-3,5-dinitrobenzamide?
N-[4-cyano-1-(4,8-dimethylquinolin-2-yl)pyrazol-5-yl]-2-methyl-3,5-dinitrobenzamide has a molecular weight of 471.43 g/mol, XLogP of 4.29, 5 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-cyano-1-(4,8-dimethylquinolin-2-yl)pyrazol-5-yl]-2-methyl-3,5-dinitrobenzamide is sourced from PubChem (CID 108747322), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).