C20H21BrN4O3 — CID 108747531
ethyl 5-(2-bromobutanoylamino)-1-(4-methylquinolin-2-yl)pyrazole-4-carboxylate (PubChem CID 108747531) has the molecular formula C20H21BrN4O3 and a molecular weight of 445.32 g/mol. Its IUPAC name is ethyl 5-(2-bromobutanoylamino)-1-(4-methylquinolin-2-yl)pyrazole-4-carboxylate.
| Compound Name | ethyl 5-(2-bromobutanoylamino)-1-(4-methylquinolin-2-yl)pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 108747531 |
| Molecular Formula | C20H21BrN4O3 |
| Molecular Weight | 445.32 g/mol |
| Exact Mass | 444.08 |
| IUPAC Name | ethyl 5-(2-bromobutanoylamino)-1-(4-methylquinolin-2-yl)pyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cnn(-c2cc(C)c3ccccc3n2)c1NC(=O)C(Br)CC |
| InChI | InChI=1S/C20H21BrN4O3/c1-4-15(21)19(26)24-18-14(20(27)28-5-2)11-22-25(18)17-10-12(3)13-8-6-7-9-16(13)23-17/h6-11,15H,4-5H2,1-3H3,(H,24,26) |
| InChIKey | RURDSZZDIOEOQK-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.32 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|