C27H26N4O5 — CID 108769638
ethyl 1-(4-methylquinolin-2-yl)-5-[[2-(2-prop-2-enoxyphenoxy)acetyl]amino]pyrazole-4-carboxylate (PubChem CID 108769638) has the molecular formula C27H26N4O5 and a molecular weight of 486.53 g/mol. Its IUPAC name is ethyl 1-(4-methylquinolin-2-yl)-5-[[2-(2-prop-2-enoxyphenoxy)acetyl]amino]pyrazole-4-carboxylate.
| Compound Name | ethyl 1-(4-methylquinolin-2-yl)-5-[[2-(2-prop-2-enoxyphenoxy)acetyl]amino]pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 108769638 |
| Molecular Formula | C27H26N4O5 |
| Molecular Weight | 486.53 g/mol |
| Exact Mass | 486.19 |
| IUPAC Name | ethyl 1-(4-methylquinolin-2-yl)-5-[[2-(2-prop-2-enoxyphenoxy)acetyl]amino]pyrazole-4-carboxylate |
| SMILES | C=CCOc1ccccc1OCC(=O)Nc1c(C(=O)OCC)cnn1-c1cc(C)c2ccccc2n1 |
| InChI | InChI=1S/C27H26N4O5/c1-4-14-35-22-12-8-9-13-23(22)36-17-25(32)30-26-20(27(33)34-5-2)16-28-31(26)24-15-18(3)19-10-6-7-11-21(19)29-24/h4,6-13,15-16H,1,5,14,17H2,2-3H3,(H,30,32) |
| InChIKey | LYQOIIPYTCRRPH-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 104.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.53 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|