C23H21N3O2S — CID 108749924
(E)-N-(5-benzoyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl)-3-(4-methylphenyl)prop-2-enamide (PubChem CID 108749924) has the molecular formula C23H21N3O2S and a molecular weight of 403.51 g/mol. Its IUPAC name is (E)-N-(5-benzoyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl)-3-(4-methylphenyl)prop-2-enamide.
| Compound Name | (E)-N-(5-benzoyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl)-3-(4-methylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 108749924 |
| Molecular Formula | C23H21N3O2S |
| Molecular Weight | 403.51 g/mol |
| Exact Mass | 403.14 |
| IUPAC Name | (E)-N-(5-benzoyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl)-3-(4-methylphenyl)prop-2-enamide |
| SMILES | Cc1ccc(/C=C/C(=O)Nc2nc3c(s2)CN(C(=O)c2ccccc2)CC3)cc1 |
| InChI | InChI=1S/C23H21N3O2S/c1-16-7-9-17(10-8-16)11-12-21(27)25-23-24-19-13-14-26(15-20(19)29-23)22(28)18-5-3-2-4-6-18/h2-12H,13-15H2,1H3,(H,24,25,27)/b12-11+ |
| InChIKey | KTRZKGSTLHACHW-VAWYXSNFSA-N |
| XLogP | 4.30 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.51 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|