C22H17Cl2N3O2S — CID 108749929
(E)-N-(5-benzoyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl)-3-(3,4-dichlorophenyl)prop-2-enamide (PubChem CID 108749929) has the molecular formula C22H17Cl2N3O2S and a molecular weight of 458.37 g/mol. Its IUPAC name is (E)-N-(5-benzoyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl)-3-(3,4-dichlorophenyl)prop-2-enamide.
| Compound Name | (E)-N-(5-benzoyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl)-3-(3,4-dichlorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 108749929 |
| Molecular Formula | C22H17Cl2N3O2S |
| Molecular Weight | 458.37 g/mol |
| Exact Mass | 457.04 |
| IUPAC Name | (E)-N-(5-benzoyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl)-3-(3,4-dichlorophenyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(Cl)c(Cl)c1)Nc1nc2c(s1)CN(C(=O)c1ccccc1)CC2 |
| InChI | InChI=1S/C22H17Cl2N3O2S/c23-16-8-6-14(12-17(16)24)7-9-20(28)26-22-25-18-10-11-27(13-19(18)30-22)21(29)15-4-2-1-3-5-15/h1-9,12H,10-11,13H2,(H,25,26,28)/b9-7+ |
| InChIKey | GJSQWFFTJSYPIB-VQHVLOKHSA-N |
| XLogP | 5.30 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.37 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|