C23H21Cl2N3O3S — CID 108725674
N-(5-benzoyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl)-4-(2,4-dichlorophenoxy)butanamide (PubChem CID 108725674) has the molecular formula C23H21Cl2N3O3S and a molecular weight of 490.41 g/mol. Its IUPAC name is N-(5-benzoyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl)-4-(2,4-dichlorophenoxy)butanamide.
| Compound Name | N-(5-benzoyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl)-4-(2,4-dichlorophenoxy)butanamide |
|---|---|
| PubChem CID | 108725674 |
| Molecular Formula | C23H21Cl2N3O3S |
| Molecular Weight | 490.41 g/mol |
| Exact Mass | 489.07 |
| IUPAC Name | N-(5-benzoyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl)-4-(2,4-dichlorophenoxy)butanamide |
| SMILES | O=C(CCCOc1ccc(Cl)cc1Cl)Nc1nc2c(s1)CN(C(=O)c1ccccc1)CC2 |
| InChI | InChI=1S/C23H21Cl2N3O3S/c24-16-8-9-19(17(25)13-16)31-12-4-7-21(29)27-23-26-18-10-11-28(14-20(18)32-23)22(30)15-5-2-1-3-6-15/h1-3,5-6,8-9,13H,4,7,10-12,14H2,(H,26,27,29) |
| InChIKey | TWESGUMZIKGFCY-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.41 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|