C17H19Cl2N3O2S — CID 31245890
4-(2,4-dichlorophenoxy)-N-(5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl)butanamide (PubChem CID 31245890) has the molecular formula C17H19Cl2N3O2S and a molecular weight of 400.33 g/mol. Its IUPAC name is 4-(2,4-dichlorophenoxy)-N-(5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl)butanamide.
| Compound Name | 4-(2,4-dichlorophenoxy)-N-(5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl)butanamide |
|---|---|
| PubChem CID | 31245890 |
| Molecular Formula | C17H19Cl2N3O2S |
| Molecular Weight | 400.33 g/mol |
| Exact Mass | 399.06 |
| IUPAC Name | 4-(2,4-dichlorophenoxy)-N-(5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl)butanamide |
| SMILES | CN1CCc2nc(NC(=O)CCCOc3ccc(Cl)cc3Cl)sc2C1 |
| InChI | InChI=1S/C17H19Cl2N3O2S/c1-22-7-6-13-15(10-22)25-17(20-13)21-16(23)3-2-8-24-14-5-4-11(18)9-12(14)19/h4-5,9H,2-3,6-8,10H2,1H3,(H,20,21,23) |
| InChIKey | WBINMIMESPONPK-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.33 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|