C23H22ClN3O3S — CID 108749966
N-(5-benzoyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl)-4-(4-chlorophenoxy)butanamide (PubChem CID 108749966) has the molecular formula C23H22ClN3O3S and a molecular weight of 455.97 g/mol. Its IUPAC name is N-(5-benzoyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl)-4-(4-chlorophenoxy)butanamide.
| Compound Name | N-(5-benzoyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl)-4-(4-chlorophenoxy)butanamide |
|---|---|
| PubChem CID | 108749966 |
| Molecular Formula | C23H22ClN3O3S |
| Molecular Weight | 455.97 g/mol |
| Exact Mass | 455.11 |
| IUPAC Name | N-(5-benzoyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl)-4-(4-chlorophenoxy)butanamide |
| SMILES | O=C(CCCOc1ccc(Cl)cc1)Nc1nc2c(s1)CN(C(=O)c1ccccc1)CC2 |
| InChI | InChI=1S/C23H22ClN3O3S/c24-17-8-10-18(11-9-17)30-14-4-7-21(28)26-23-25-19-12-13-27(15-20(19)31-23)22(29)16-5-2-1-3-6-16/h1-3,5-6,8-11H,4,7,12-15H2,(H,25,26,28) |
| InChIKey | KRTZOEGETDESMQ-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.97 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|