C25H35N3O3S — CID 108749839
4-(4-tert-butylphenoxy)-N-[5-(3-methylbutanoyl)-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl]butanamide (PubChem CID 108749839) has the molecular formula C25H35N3O3S and a molecular weight of 457.64 g/mol. Its IUPAC name is 4-(4-tert-butylphenoxy)-N-[5-(3-methylbutanoyl)-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl]butanamide.
| Compound Name | 4-(4-tert-butylphenoxy)-N-[5-(3-methylbutanoyl)-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl]butanamide |
|---|---|
| PubChem CID | 108749839 |
| Molecular Formula | C25H35N3O3S |
| Molecular Weight | 457.64 g/mol |
| Exact Mass | 457.24 |
| IUPAC Name | 4-(4-tert-butylphenoxy)-N-[5-(3-methylbutanoyl)-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl]butanamide |
| SMILES | CC(C)CC(=O)N1CCc2nc(NC(=O)CCCOc3ccc(C(C)(C)C)cc3)sc2C1 |
| InChI | InChI=1S/C25H35N3O3S/c1-17(2)15-23(30)28-13-12-20-21(16-28)32-24(26-20)27-22(29)7-6-14-31-19-10-8-18(9-11-19)25(3,4)5/h8-11,17H,6-7,12-16H2,1-5H3,(H,26,27,29) |
| InChIKey | ZIDVYTCCCJCRBH-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.64 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|