C27H25N3O3S — CID 108749961
N-(5-benzoyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl)-4-naphthalen-2-yloxybutanamide (PubChem CID 108749961) has the molecular formula C27H25N3O3S and a molecular weight of 471.58 g/mol. Its IUPAC name is N-(5-benzoyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl)-4-naphthalen-2-yloxybutanamide.
| Compound Name | N-(5-benzoyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl)-4-naphthalen-2-yloxybutanamide |
|---|---|
| PubChem CID | 108749961 |
| Molecular Formula | C27H25N3O3S |
| Molecular Weight | 471.58 g/mol |
| Exact Mass | 471.16 |
| IUPAC Name | N-(5-benzoyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl)-4-naphthalen-2-yloxybutanamide |
| SMILES | O=C(CCCOc1ccc2ccccc2c1)Nc1nc2c(s1)CN(C(=O)c1ccccc1)CC2 |
| InChI | InChI=1S/C27H25N3O3S/c31-25(11-6-16-33-22-13-12-19-7-4-5-10-21(19)17-22)29-27-28-23-14-15-30(18-24(23)34-27)26(32)20-8-2-1-3-9-20/h1-5,7-10,12-13,17H,6,11,14-16,18H2,(H,28,29,31) |
| InChIKey | YQQPSUFWEWTTHR-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.58 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|