C22H24N2O7 — CID 108753947
3-[[1-[2-(3,4-dimethoxyphenyl)ethyl]-5-oxopyrrolidine-3-carbonyl]amino]-4-hydroxybenzoic acid (PubChem CID 108753947) has the molecular formula C22H24N2O7 and a molecular weight of 428.44 g/mol. Its IUPAC name is 3-[[1-[2-(3,4-dimethoxyphenyl)ethyl]-5-oxopyrrolidine-3-carbonyl]amino]-4-hydroxybenzoic acid.
| Compound Name | 3-[[1-[2-(3,4-dimethoxyphenyl)ethyl]-5-oxopyrrolidine-3-carbonyl]amino]-4-hydroxybenzoic acid |
|---|---|
| PubChem CID | 108753947 |
| Molecular Formula | C22H24N2O7 |
| Molecular Weight | 428.44 g/mol |
| Exact Mass | 428.16 |
| IUPAC Name | 3-[[1-[2-(3,4-dimethoxyphenyl)ethyl]-5-oxopyrrolidine-3-carbonyl]amino]-4-hydroxybenzoic acid |
| SMILES | COc1ccc(CCN2CC(C(=O)Nc3cc(C(=O)O)ccc3O)CC2=O)cc1OC |
| InChI | InChI=1S/C22H24N2O7/c1-30-18-6-3-13(9-19(18)31-2)7-8-24-12-15(11-20(24)26)21(27)23-16-10-14(22(28)29)4-5-17(16)25/h3-6,9-10,15,25H,7-8,11-12H2,1-2H3,(H,23,27)(H,28,29) |
| InChIKey | QBZLNUXKVKFQQY-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 125.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.44 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|