C22H25N3O7 — CID 108767439
1-[2-(3,4-dimethoxyphenyl)ethyl]-N-(2-methoxy-4-nitrophenyl)-5-oxopyrrolidine-3-carboxamide (PubChem CID 108767439) has the molecular formula C22H25N3O7 and a molecular weight of 443.46 g/mol. Its IUPAC name is 1-[2-(3,4-dimethoxyphenyl)ethyl]-N-(2-methoxy-4-nitrophenyl)-5-oxopyrrolidine-3-carboxamide.
| Compound Name | 1-[2-(3,4-dimethoxyphenyl)ethyl]-N-(2-methoxy-4-nitrophenyl)-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 108767439 |
| Molecular Formula | C22H25N3O7 |
| Molecular Weight | 443.46 g/mol |
| Exact Mass | 443.17 |
| IUPAC Name | 1-[2-(3,4-dimethoxyphenyl)ethyl]-N-(2-methoxy-4-nitrophenyl)-5-oxopyrrolidine-3-carboxamide |
| SMILES | COc1cc([N+](=O)[O-])ccc1NC(=O)C1CC(=O)N(CCc2ccc(OC)c(OC)c2)C1 |
| InChI | InChI=1S/C22H25N3O7/c1-30-18-7-4-14(10-20(18)32-3)8-9-24-13-15(11-21(24)26)22(27)23-17-6-5-16(25(28)29)12-19(17)31-2/h4-7,10,12,15H,8-9,11,13H2,1-3H3,(H,23,27) |
| InChIKey | CEWWLLXNROGWGA-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 120.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.46 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|