C15H11Cl2NO5 — CID 108753972
3-[[2-(2,4-dichlorophenoxy)acetyl]amino]-4-hydroxybenzoic acid (PubChem CID 108753972) has the molecular formula C15H11Cl2NO5 and a molecular weight of 356.16 g/mol. Its IUPAC name is 3-[[2-(2,4-dichlorophenoxy)acetyl]amino]-4-hydroxybenzoic acid.
| Compound Name | 3-[[2-(2,4-dichlorophenoxy)acetyl]amino]-4-hydroxybenzoic acid |
|---|---|
| PubChem CID | 108753972 |
| Molecular Formula | C15H11Cl2NO5 |
| Molecular Weight | 356.16 g/mol |
| Exact Mass | 355.00 |
| IUPAC Name | 3-[[2-(2,4-dichlorophenoxy)acetyl]amino]-4-hydroxybenzoic acid |
| SMILES | O=C(COc1ccc(Cl)cc1Cl)Nc1cc(C(=O)O)ccc1O |
| InChI | InChI=1S/C15H11Cl2NO5/c16-9-2-4-13(10(17)6-9)23-7-14(20)18-11-5-8(15(21)22)1-3-12(11)19/h1-6,19H,7H2,(H,18,20)(H,21,22) |
| InChIKey | DYPXANAIOXAZIW-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.16 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|