C21H25NO5 — CID 108753977
3-[4-(4-tert-butylphenoxy)butanoylamino]-4-hydroxybenzoic acid (PubChem CID 108753977) has the molecular formula C21H25NO5 and a molecular weight of 371.43 g/mol. Its IUPAC name is 3-[4-(4-tert-butylphenoxy)butanoylamino]-4-hydroxybenzoic acid.
| Compound Name | 3-[4-(4-tert-butylphenoxy)butanoylamino]-4-hydroxybenzoic acid |
|---|---|
| PubChem CID | 108753977 |
| Molecular Formula | C21H25NO5 |
| Molecular Weight | 371.43 g/mol |
| Exact Mass | 371.17 |
| IUPAC Name | 3-[4-(4-tert-butylphenoxy)butanoylamino]-4-hydroxybenzoic acid |
| SMILES | CC(C)(C)c1ccc(OCCCC(=O)Nc2cc(C(=O)O)ccc2O)cc1 |
| InChI | InChI=1S/C21H25NO5/c1-21(2,3)15-7-9-16(10-8-15)27-12-4-5-19(24)22-17-13-14(20(25)26)6-11-18(17)23/h6-11,13,23H,4-5,12H2,1-3H3,(H,22,24)(H,25,26) |
| InChIKey | CJCHLMKUQBCNFN-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.43 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|