C17H18ClN3O2S — CID 108754688
3-chloro-N-[4-(1,3,3-trimethyl-2-oxoindol-5-yl)-1,3-thiazol-2-yl]propanamide (PubChem CID 108754688) has the molecular formula C17H18ClN3O2S and a molecular weight of 363.87 g/mol. Its IUPAC name is 3-chloro-N-[4-(1,3,3-trimethyl-2-oxoindol-5-yl)-1,3-thiazol-2-yl]propanamide.
| Compound Name | 3-chloro-N-[4-(1,3,3-trimethyl-2-oxoindol-5-yl)-1,3-thiazol-2-yl]propanamide |
|---|---|
| PubChem CID | 108754688 |
| Molecular Formula | C17H18ClN3O2S |
| Molecular Weight | 363.87 g/mol |
| Exact Mass | 363.08 |
| IUPAC Name | 3-chloro-N-[4-(1,3,3-trimethyl-2-oxoindol-5-yl)-1,3-thiazol-2-yl]propanamide |
| SMILES | CN1C(=O)C(C)(C)c2cc(-c3csc(NC(=O)CCCl)n3)ccc21 |
| InChI | InChI=1S/C17H18ClN3O2S/c1-17(2)11-8-10(4-5-13(11)21(3)15(17)23)12-9-24-16(19-12)20-14(22)6-7-18/h4-5,8-9H,6-7H2,1-3H3,(H,19,20,22) |
| InChIKey | RHGVNFOJTNBAED-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.87 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|