C21H18N4O4S — CID 108754607
4-nitro-N-[4-(1,3,3-trimethyl-2-oxoindol-5-yl)-1,3-thiazol-2-yl]benzamide (PubChem CID 108754607) has the molecular formula C21H18N4O4S and a molecular weight of 422.47 g/mol. Its IUPAC name is 4-nitro-N-[4-(1,3,3-trimethyl-2-oxoindol-5-yl)-1,3-thiazol-2-yl]benzamide.
| Compound Name | 4-nitro-N-[4-(1,3,3-trimethyl-2-oxoindol-5-yl)-1,3-thiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 108754607 |
| Molecular Formula | C21H18N4O4S |
| Molecular Weight | 422.47 g/mol |
| Exact Mass | 422.10 |
| IUPAC Name | 4-nitro-N-[4-(1,3,3-trimethyl-2-oxoindol-5-yl)-1,3-thiazol-2-yl]benzamide |
| SMILES | CN1C(=O)C(C)(C)c2cc(-c3csc(NC(=O)c4ccc([N+](=O)[O-])cc4)n3)ccc21 |
| InChI | InChI=1S/C21H18N4O4S/c1-21(2)15-10-13(6-9-17(15)24(3)19(21)27)16-11-30-20(22-16)23-18(26)12-4-7-14(8-5-12)25(28)29/h4-11H,1-3H3,(H,22,23,26) |
| InChIKey | TXTARXFWGUEBBO-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 105.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.47 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|