C27H22N4O2S — CID 108755058
(Z)-N-[2-(6-methoxy-1,3-benzothiazol-2-yl)-5-methylpyrazol-3-yl]-2,3-diphenylprop-2-enamide (PubChem CID 108755058) has the molecular formula C27H22N4O2S and a molecular weight of 466.57 g/mol. Its IUPAC name is (Z)-N-[2-(6-methoxy-1,3-benzothiazol-2-yl)-5-methylpyrazol-3-yl]-2,3-diphenylprop-2-enamide.
| Compound Name | (Z)-N-[2-(6-methoxy-1,3-benzothiazol-2-yl)-5-methylpyrazol-3-yl]-2,3-diphenylprop-2-enamide |
|---|---|
| PubChem CID | 108755058 |
| Molecular Formula | C27H22N4O2S |
| Molecular Weight | 466.57 g/mol |
| Exact Mass | 466.15 |
| IUPAC Name | (Z)-N-[2-(6-methoxy-1,3-benzothiazol-2-yl)-5-methylpyrazol-3-yl]-2,3-diphenylprop-2-enamide |
| SMILES | COc1ccc2nc(-n3nc(C)cc3NC(=O)/C(=C\c3ccccc3)c3ccccc3)sc2c1 |
| InChI | InChI=1S/C27H22N4O2S/c1-18-15-25(31(30-18)27-28-23-14-13-21(33-2)17-24(23)34-27)29-26(32)22(20-11-7-4-8-12-20)16-19-9-5-3-6-10-19/h3-17H,1-2H3,(H,29,32)/b22-16- |
| InChIKey | NQQYAFDGTQPKDI-JWGURIENSA-N |
| XLogP | 5.98 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.57 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|