C26H24N4O3S — CID 108755088
N-[2-(6-methoxy-1,3-benzothiazol-2-yl)-5-methylpyrazol-3-yl]-4-naphthalen-2-yloxybutanamide (PubChem CID 108755088) has the molecular formula C26H24N4O3S and a molecular weight of 472.57 g/mol. Its IUPAC name is N-[2-(6-methoxy-1,3-benzothiazol-2-yl)-5-methylpyrazol-3-yl]-4-naphthalen-2-yloxybutanamide.
| Compound Name | N-[2-(6-methoxy-1,3-benzothiazol-2-yl)-5-methylpyrazol-3-yl]-4-naphthalen-2-yloxybutanamide |
|---|---|
| PubChem CID | 108755088 |
| Molecular Formula | C26H24N4O3S |
| Molecular Weight | 472.57 g/mol |
| Exact Mass | 472.16 |
| IUPAC Name | N-[2-(6-methoxy-1,3-benzothiazol-2-yl)-5-methylpyrazol-3-yl]-4-naphthalen-2-yloxybutanamide |
| SMILES | COc1ccc2nc(-n3nc(C)cc3NC(=O)CCCOc3ccc4ccccc4c3)sc2c1 |
| InChI | InChI=1S/C26H24N4O3S/c1-17-14-24(30(29-17)26-27-22-12-11-20(32-2)16-23(22)34-26)28-25(31)8-5-13-33-21-10-9-18-6-3-4-7-19(18)15-21/h3-4,6-7,9-12,14-16H,5,8,13H2,1-2H3,(H,28,31) |
| InChIKey | NHUWGHHBYJSJAA-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.57 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|