C17H23NO6S — CID 108755203
2-[[(E)-3-(4-ethoxyphenyl)prop-2-enoyl]amino]-4-ethylsulfonylbutanoic acid (PubChem CID 108755203) has the molecular formula C17H23NO6S and a molecular weight of 369.44 g/mol. Its IUPAC name is 2-[[(E)-3-(4-ethoxyphenyl)prop-2-enoyl]amino]-4-ethylsulfonylbutanoic acid.
| Compound Name | 2-[[(E)-3-(4-ethoxyphenyl)prop-2-enoyl]amino]-4-ethylsulfonylbutanoic acid |
|---|---|
| PubChem CID | 108755203 |
| Molecular Formula | C17H23NO6S |
| Molecular Weight | 369.44 g/mol |
| Exact Mass | 369.12 |
| IUPAC Name | 2-[[(E)-3-(4-ethoxyphenyl)prop-2-enoyl]amino]-4-ethylsulfonylbutanoic acid |
| SMILES | CCOc1ccc(/C=C/C(=O)NC(CCS(=O)(=O)CC)C(=O)O)cc1 |
| InChI | InChI=1S/C17H23NO6S/c1-3-24-14-8-5-13(6-9-14)7-10-16(19)18-15(17(20)21)11-12-25(22,23)4-2/h5-10,15H,3-4,11-12H2,1-2H3,(H,18,19)(H,20,21)/b10-7+ |
| InChIKey | HNZGKYCHQMZVCA-JXMROGBWSA-N |
| XLogP | 1.49 |
| TPSA | 109.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.44 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|