C11H18ClNO3 — CID 108755885
trans-(1S,2R)-2-[(3-chloropropanoylamino)methyl]cyclohexane-1-carboxylic acid (PubChem CID 108755885) has the molecular formula C11H18ClNO3 and a molecular weight of 247.72 g/mol. Its IUPAC name is trans-(1S,2R)-2-[(3-chloropropanoylamino)methyl]cyclohexane-1-carboxylic acid.
| Compound Name | trans-(1S,2R)-2-[(3-chloropropanoylamino)methyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 108755885 |
| Molecular Formula | C11H18ClNO3 |
| Molecular Weight | 247.72 g/mol |
| Exact Mass | 247.10 |
| IUPAC Name | trans-(1S,2R)-2-[(3-chloropropanoylamino)methyl]cyclohexane-1-carboxylic acid |
| SMILES | O=C(CCCl)NC[C@@H]1CCCC[C@@H]1C(=O)O |
| InChI | InChI=1S/C11H18ClNO3/c12-6-5-10(14)13-7-8-3-1-2-4-9(8)11(15)16/h8-9H,1-7H2,(H,13,14)(H,15,16)/t8-,9-/m0/s1 |
| InChIKey | HDCRZJWJHBTZJB-IUCAKERBSA-N |
| XLogP | 1.62 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.72 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|