C8H13NO3 — CID 130649468
trans-(1R,2S)-2-(formamidomethyl)cyclopentane-1-carboxylic acid (PubChem CID 130649468) has the molecular formula C8H13NO3 and a molecular weight of 171.20 g/mol. Its IUPAC name is trans-(1R,2S)-2-(formamidomethyl)cyclopentane-1-carboxylic acid.
| Compound Name | trans-(1R,2S)-2-(formamidomethyl)cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 130649468 |
| Molecular Formula | C8H13NO3 |
| Molecular Weight | 171.20 g/mol |
| Exact Mass | 171.09 |
| IUPAC Name | trans-(1R,2S)-2-(formamidomethyl)cyclopentane-1-carboxylic acid |
| SMILES | O=CNC[C@H]1CCC[C@H]1C(=O)O |
| InChI | InChI=1S/C8H13NO3/c10-5-9-4-6-2-1-3-7(6)8(11)12/h5-7H,1-4H2,(H,9,10)(H,11,12)/t6-,7-/m1/s1 |
| InChIKey | MWPZSWJGOQXJHG-RNFRBKRXSA-N |
| XLogP | 0.23 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.20 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|