C11H20N4O4 — CID 83114129
2-[[2-(carbamoylamino)ethylcarbamoylamino]methyl]cyclopentane-1-carboxylic acid (PubChem CID 83114129) has the molecular formula C11H20N4O4 and a molecular weight of 272.31 g/mol. Its IUPAC name is 2-[[2-(carbamoylamino)ethylcarbamoylamino]methyl]cyclopentane-1-carboxylic acid.
| Compound Name | 2-[[2-(carbamoylamino)ethylcarbamoylamino]methyl]cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 83114129 |
| Molecular Formula | C11H20N4O4 |
| Molecular Weight | 272.31 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | 2-[[2-(carbamoylamino)ethylcarbamoylamino]methyl]cyclopentane-1-carboxylic acid |
| SMILES | NC(=O)NCCNC(=O)NCC1CCCC1C(=O)O |
| InChI | InChI=1S/C11H20N4O4/c12-10(18)13-4-5-14-11(19)15-6-7-2-1-3-8(7)9(16)17/h7-8H,1-6H2,(H,16,17)(H3,12,13,18)(H2,14,15,19) |
| InChIKey | AGRLAWPQOCHYEE-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 133.55 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.31 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|