C11H16F4N2O3 — CID 106294840
2-[(2,2,3,3-tetrafluoropropylcarbamoylamino)methyl]cyclopentane-1-carboxylic acid (PubChem CID 106294840) has the molecular formula C11H16F4N2O3 and a molecular weight of 300.25 g/mol. Its IUPAC name is 2-[(2,2,3,3-tetrafluoropropylcarbamoylamino)methyl]cyclopentane-1-carboxylic acid.
| Compound Name | 2-[(2,2,3,3-tetrafluoropropylcarbamoylamino)methyl]cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 106294840 |
| Molecular Formula | C11H16F4N2O3 |
| Molecular Weight | 300.25 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | 2-[(2,2,3,3-tetrafluoropropylcarbamoylamino)methyl]cyclopentane-1-carboxylic acid |
| SMILES | O=C(NCC1CCCC1C(=O)O)NCC(F)(F)C(F)F |
| InChI | InChI=1S/C11H16F4N2O3/c12-9(13)11(14,15)5-17-10(20)16-4-6-2-1-3-7(6)8(18)19/h6-7,9H,1-5H2,(H,18,19)(H2,16,17,20) |
| InChIKey | NBVQNKADJVNBAP-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.25 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|