C22H20BrClN2O3 — CID 108756036
4-(2-bromo-4-chlorophenoxy)-N-(2-hydroxyphenyl)-N-(pyridin-2-ylmethyl)butanamide (PubChem CID 108756036) has the molecular formula C22H20BrClN2O3 and a molecular weight of 475.77 g/mol. Its IUPAC name is 4-(2-bromo-4-chlorophenoxy)-N-(2-hydroxyphenyl)-N-(pyridin-2-ylmethyl)butanamide.
| Compound Name | 4-(2-bromo-4-chlorophenoxy)-N-(2-hydroxyphenyl)-N-(pyridin-2-ylmethyl)butanamide |
|---|---|
| PubChem CID | 108756036 |
| Molecular Formula | C22H20BrClN2O3 |
| Molecular Weight | 475.77 g/mol |
| Exact Mass | 474.03 |
| IUPAC Name | 4-(2-bromo-4-chlorophenoxy)-N-(2-hydroxyphenyl)-N-(pyridin-2-ylmethyl)butanamide |
| SMILES | O=C(CCCOc1ccc(Cl)cc1Br)N(Cc1ccccn1)c1ccccc1O |
| InChI | InChI=1S/C22H20BrClN2O3/c23-18-14-16(24)10-11-21(18)29-13-5-9-22(28)26(15-17-6-3-4-12-25-17)19-7-1-2-8-20(19)27/h1-4,6-8,10-12,14,27H,5,9,13,15H2 |
| InChIKey | XHIFGXJKMBGPQH-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.77 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|