C20H18INO3 — CID 108757554
1'-(2-iodobenzoyl)spiro[3H-chromene-2,4'-piperidine]-4-one (PubChem CID 108757554) has the molecular formula C20H18INO3 and a molecular weight of 447.27 g/mol. Its IUPAC name is 1'-(2-iodobenzoyl)spiro[3H-chromene-2,4'-piperidine]-4-one.
| Compound Name | 1'-(2-iodobenzoyl)spiro[3H-chromene-2,4'-piperidine]-4-one |
|---|---|
| PubChem CID | 108757554 |
| Molecular Formula | C20H18INO3 |
| Molecular Weight | 447.27 g/mol |
| Exact Mass | 447.03 |
| IUPAC Name | 1'-(2-iodobenzoyl)spiro[3H-chromene-2,4'-piperidine]-4-one |
| SMILES | O=C1CC2(CCN(C(=O)c3ccccc3I)CC2)Oc2ccccc21 |
| InChI | InChI=1S/C20H18INO3/c21-16-7-3-1-5-14(16)19(24)22-11-9-20(10-12-22)13-17(23)15-6-2-4-8-18(15)25-20/h1-8H,9-13H2 |
| InChIKey | XBWUNWIWZKEZBH-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.27 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|